C15H16N4O3 — CID 70725726
N-(2-acetamidoethyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carboxamide (PubChem CID 70725726) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70725726 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(2-acetamidoethyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cnc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C15H16N4O3/c1-10(20)16-7-8-17-14(21)12-9-18-13(19-15(12)22)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H,16,20)(H,17,21)(H,18,19,22) |
| InChIKey | QFWMRDUZSQLJAB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|