C14H20N4O4S2 — CID 70725763
(4aS,7aR)-N,N-dimethyl-1-(4-methyl-1,3-thiazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70725763) has the molecular formula C14H20N4O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (4aS,7aR)-N,N-dimethyl-1-(4-methyl-1,3-thiazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-N,N-dimethyl-1-(4-methyl-1,3-thiazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70725763 |
| Molecular Formula | C14H20N4O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (4aS,7aR)-N,N-dimethyl-1-(4-methyl-1,3-thiazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | Cc1ncsc1C(=O)N1CCN(C(=O)N(C)C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H20N4O4S2/c1-9-12(23-8-15-9)13(19)17-4-5-18(14(20)16(2)3)11-7-24(21,22)6-10(11)17/h8,10-11H,4-7H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | IGGHAEUOCOJBGK-WDEREUQCSA-N |
| XLogP | 0.06 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |