C22H24N2O3 — CID 70725997
1-[2-methyl-4-(4-methylphenyl)-5-oxopiperazin-1-yl]-4-phenylbutane-1,2-dione (PubChem CID 70725997) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[2-methyl-4-(4-methylphenyl)-5-oxopiperazin-1-yl]-4-phenylbutane-1,2-dione.
| Compound Name | 1-[2-methyl-4-(4-methylphenyl)-5-oxopiperazin-1-yl]-4-phenylbutane-1,2-dione |
|---|---|
| PubChem CID | 70725997 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[2-methyl-4-(4-methylphenyl)-5-oxopiperazin-1-yl]-4-phenylbutane-1,2-dione |
| SMILES | Cc1ccc(N2CC(C)N(C(=O)C(=O)CCc3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-8-11-19(12-9-16)24-14-17(2)23(15-21(24)26)22(27)20(25)13-10-18-6-4-3-5-7-18/h3-9,11-12,17H,10,13-15H2,1-2H3 |
| InChIKey | GRLLXXPDPAIPSG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|