C16H27N3O4 — CID 70726104
[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]methanone (PubChem CID 70726104) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]methanone.
| Compound Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70726104 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]methanone |
| SMILES | CCOCCn1nc(C)cc1C(=O)N1CC[C@](O)(CC)[C@H](O)C1 |
| InChI | InChI=1S/C16H27N3O4/c1-4-16(22)6-7-18(11-14(16)20)15(21)13-10-12(3)17-19(13)8-9-23-5-2/h10,14,20,22H,4-9,11H2,1-3H3/t14-,16-/m1/s1 |
| InChIKey | QRNQOAPMJQGADH-GDBMZVCRSA-N |
| XLogP | 0.58 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|