About methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate
methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate (PubChem CID 70726935) has the molecular formula C22H26N4O3
and a molecular weight of 394.48 g/mol. Its IUPAC name is methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate |
| PubChem CID | 70726935 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(N2CCCC3(CCC(=O)N(Cc4ccccc4)C3)C2)n1 |
| InChI | InChI=1S/C22H26N4O3/c1-29-21(28)18-12-23-13-19(24-18)25-11-5-9-22(15-25)10-8-20(27)26(16-22)14-17-6-3-2-4-7-17/h2-4,6-7,12-13H,5,8-11,14-16H2,1H3 |
| InChIKey | XHYIPOUZMZZBIQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate?
The IUPAC name of methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate (CID 70726935) is methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate is COC(=O)c1cncc(N2CCCC3(CCC(=O)N(Cc4ccccc4)C3)C2)n1.
What is the InChIKey of methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate?
The InChIKey is XHYIPOUZMZZBIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O3/c1-29-21(28)18-12-23-13-19(24-18)25-11-5-9-22(15-25)10-8-20(27)26(16-22)14-17-6-3-2-4-7-17/h2-4,6-7,12-13H,5,8-11,14-16H2,1H3.
What are the key properties of methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate?
methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate has a molecular weight of 394.48 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 70726935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).