C17H23N3O5S — CID 70727818
butyl (4aR,7aS)-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate (PubChem CID 70727818) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is butyl (4aR,7aS)-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate.
| Compound Name | butyl (4aR,7aS)-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 70727818 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | butyl (4aR,7aS)-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H23N3O5S/c1-2-3-10-25-17(22)20-9-8-19(14-11-26(23,24)12-15(14)20)16(21)13-6-4-5-7-18-13/h4-7,14-15H,2-3,8-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | OIKFAJOOTYBZTE-CABCVRRESA-N |
| XLogP | 0.94 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|