C22H27N3OS — CID 70728187
3-[4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-1-yl]propan-1-ol (PubChem CID 70728187) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 3-[4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 70728187 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-[4-[(7-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]piperazin-1-yl]propan-1-ol |
| SMILES | Cc1ccc2cc(CN3CCN(CCCO)CC3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C22H27N3OS/c1-17-5-6-18-15-19(16-25-10-8-24(9-11-25)7-3-12-26)22(23-20(18)14-17)21-4-2-13-27-21/h2,4-6,13-15,26H,3,7-12,16H2,1H3 |
| InChIKey | DPOMZMMCAJLZND-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |