C18H19N7S — CID 70728202
1-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 70728202) has the molecular formula C18H19N7S and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70728202 |
| Molecular Formula | C18H19N7S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1csc(CCCNc2nc(-c3ccncc3)nc3c2cnn3C)n1 |
| InChI | InChI=1S/C18H19N7S/c1-12-11-26-15(22-12)4-3-7-20-17-14-10-21-25(2)18(14)24-16(23-17)13-5-8-19-9-6-13/h5-6,8-11H,3-4,7H2,1-2H3,(H,20,23,24) |
| InChIKey | TVVFMZGEYNZNFY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|