C18H29N7O — CID 70728504
1,1-dimethyl-3-[[5-[(1-propylimidazol-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea (PubChem CID 70728504) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[5-[(1-propylimidazol-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea.
| Compound Name | 1,1-dimethyl-3-[[5-[(1-propylimidazol-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 70728504 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 1,1-dimethyl-3-[[5-[(1-propylimidazol-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
| SMILES | CCCn1ccnc1CN1CCCn2nc(CNC(=O)N(C)C)cc2C1 |
| InChI | InChI=1S/C18H29N7O/c1-4-7-24-10-6-19-17(24)14-23-8-5-9-25-16(13-23)11-15(21-25)12-20-18(26)22(2)3/h6,10-11H,4-5,7-9,12-14H2,1-3H3,(H,20,26) |
| InChIKey | OLQUTVWROJTKMZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |