About 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine
1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 70729792) has the molecular formula C15H16N6S
and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 70729792 |
| Molecular Formula | C15H16N6S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NC3CCSC3)nc(-c3ccncc3)nc21 |
| InChI | InChI=1S/C15H16N6S/c1-21-15-12(8-17-21)14(18-11-4-7-22-9-11)19-13(20-15)10-2-5-16-6-3-10/h2-3,5-6,8,11H,4,7,9H2,1H3,(H,18,19,20) |
| InChIKey | SRXJBZZFGQSTQZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 70729792) is 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine is Cn1ncc2c(NC3CCSC3)nc(-c3ccncc3)nc21.
What is the InChIKey of 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is SRXJBZZFGQSTQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N6S/c1-21-15-12(8-17-21)14(18-11-4-7-22-9-11)19-13(20-15)10-2-5-16-6-3-10/h2-3,5-6,8,11H,4,7,9H2,1H3,(H,18,19,20).
What are the key properties of 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 312.40 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-pyridin-4-yl-N-(thiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 70729792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).