C20H32N4O2 — CID 70729957
cis-(1R,2S)-N-butyl-2-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]cyclohexane-1-carboxamide (PubChem CID 70729957) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is cis-(1R,2S)-N-butyl-2-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-butyl-2-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 70729957 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | cis-(1R,2S)-N-butyl-2-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]cyclohexane-1-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCC[C@@H]1C(=O)N1CC(n2nc(C)cc2C)C1 |
| InChI | InChI=1S/C20H32N4O2/c1-4-5-10-21-19(25)17-8-6-7-9-18(17)20(26)23-12-16(13-23)24-15(3)11-14(2)22-24/h11,16-18H,4-10,12-13H2,1-3H3,(H,21,25)/t17-,18+/m1/s1 |
| InChIKey | CIGWOKPBZQRCOO-MSOLQXFVSA-N |
| XLogP | 2.61 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|