C17H24N4OS — CID 70729987
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-3-(4-methyl-1,3-thiazol-5-yl)propanamide (PubChem CID 70729987) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-3-(4-methyl-1,3-thiazol-5-yl)propanamide.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-3-(4-methyl-1,3-thiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 70729987 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-3-(4-methyl-1,3-thiazol-5-yl)propanamide |
| SMILES | Cc1ncsc1CCC(=O)N(C)Cc1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C17H24N4OS/c1-12-16(23-11-18-12)8-9-17(22)21(2)10-15-13-6-4-3-5-7-14(13)19-20-15/h11H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | WGWQDOMDPNDKDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |