C24H24N2O — CID 7073015
N-[(2R,3S,6S)-3-benzyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine (PubChem CID 7073015) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(2R,3S,6S)-3-benzyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[(2R,3S,6S)-3-benzyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7073015 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[(2R,3S,6S)-3-benzyl-2,6-diphenylpiperidin-4-ylidene]hydroxylamine |
| SMILES | ON=C1C[C@@H](c2ccccc2)N[C@@H](c2ccccc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O/c27-26-23-17-22(19-12-6-2-7-13-19)25-24(20-14-8-3-9-15-20)21(23)16-18-10-4-1-5-11-18/h1-15,21-22,24-25,27H,16-17H2/t21-,22+,24+/m1/s1 |
| InChIKey | ODMJIIJUJAYBCI-GPXNEJASSA-N |
| XLogP | 5.15 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|