C16H21F3N2O2 — CID 70730336
4,4,4-trifluoro-1-[4-(2-phenoxyethyl)piperazin-1-yl]butan-1-one (PubChem CID 70730336) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-(2-phenoxyethyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[4-(2-phenoxyethyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70730336 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-(2-phenoxyethyl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21F3N2O2/c17-16(18,19)7-6-15(22)21-10-8-20(9-11-21)12-13-23-14-4-2-1-3-5-14/h1-5H,6-13H2 |
| InChIKey | VIHRROOCXVZBDT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |