C14H22N4O5S2 — CID 70730422
1-[(4aR,7aS)-4-(1-methylimidazol-4-yl)sulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-methylpropan-1-one (PubChem CID 70730422) has the molecular formula C14H22N4O5S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(1-methylimidazol-4-yl)sulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(1-methylimidazol-4-yl)sulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 70730422 |
| Molecular Formula | C14H22N4O5S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[(4aR,7aS)-4-(1-methylimidazol-4-yl)sulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(S(=O)(=O)c2cn(C)cn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H22N4O5S2/c1-10(2)14(19)17-4-5-18(12-8-24(20,21)7-11(12)17)25(22,23)13-6-16(3)9-15-13/h6,9-12H,4-5,7-8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | LOIQCPIEAVGXQM-NEPJUHHUSA-N |
| XLogP | -0.93 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |