C16H26N4O2 — CID 70730748
N-(3-cyclohexyloxypropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 70730748) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70730748 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)C1NCCc2[nH]cnc21 |
| InChI | InChI=1S/C16H26N4O2/c21-16(15-14-13(7-9-17-15)19-11-20-14)18-8-4-10-22-12-5-2-1-3-6-12/h11-12,15,17H,1-10H2,(H,18,21)(H,19,20) |
| InChIKey | MYULKUXEYQSEMP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|