C16H17FN4O — CID 70730781
[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-pyridazin-3-ylmethanone (PubChem CID 70730781) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is [4-[(3-fluorophenyl)methyl]piperazin-1-yl]-pyridazin-3-ylmethanone.
| Compound Name | [4-[(3-fluorophenyl)methyl]piperazin-1-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 70730781 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [4-[(3-fluorophenyl)methyl]piperazin-1-yl]-pyridazin-3-ylmethanone |
| SMILES | O=C(c1cccnn1)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H17FN4O/c17-14-4-1-3-13(11-14)12-20-7-9-21(10-8-20)16(22)15-5-2-6-18-19-15/h1-6,11H,7-10,12H2 |
| InChIKey | XHBDGAUDRVMDJP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |