About 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate
6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate (PubChem CID 7073085) has the molecular formula C16H13N4O8-
and a molecular weight of 389.30 g/mol. Its IUPAC name is 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate.
Molecular Properties
| Compound Name | 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
| PubChem CID | 7073085 |
| Molecular Formula | C16H13N4O8- |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
| SMILES | COc1ccc(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C16H14N4O8/c1-27-13-6-3-9(14(16(21)22)15(13)28-2)8-17-18-11-5-4-10(19(23)24)7-12(11)20(25)26/h3-8,18H,1-2H3,(H,21,22)/p-1/b17-8- |
| InChIKey | MZOWRDVJTQNQLQ-IUXPMGMMSA-M |
| XLogP | 1.33 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate?
The IUPAC name of 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate (CID 7073085) is 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate.
What is the SMILES notation for 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate?
The canonical SMILES for 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate is COc1ccc(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C(=O)[O-])c1OC.
What is the InChIKey of 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate?
The InChIKey is MZOWRDVJTQNQLQ-IUXPMGMMSA-M. The full InChI is InChI=1S/C16H14N4O8/c1-27-13-6-3-9(14(16(21)22)15(13)28-2)8-17-18-11-5-4-10(19(23)24)7-12(11)20(25)26/h3-8,18H,1-2H3,(H,21,22)/p-1/b17-8-.
What are the key properties of 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate?
6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate has a molecular weight of 389.30 g/mol, XLogP of 1.33, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate is sourced from PubChem (CID 7073085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).