C21H22FN3O — CID 70730908
N-[[2-(2-fluorophenyl)-3-methyl-1H-indol-5-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 70730908) has the molecular formula C21H22FN3O and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-3-methyl-1H-indol-5-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[2-(2-fluorophenyl)-3-methyl-1H-indol-5-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70730908 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-3-methyl-1H-indol-5-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1c(-c2ccccc2F)[nH]c2ccc(CNC(=O)C3CCCN3)cc12 |
| InChI | InChI=1S/C21H22FN3O/c1-13-16-11-14(12-24-21(26)19-7-4-10-23-19)8-9-18(16)25-20(13)15-5-2-3-6-17(15)22/h2-3,5-6,8-9,11,19,23,25H,4,7,10,12H2,1H3,(H,24,26) |
| InChIKey | AFFIVWPUAZADNA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |