About 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole
5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole (PubChem CID 70731003) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole |
| PubChem CID | 70731003 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2cc(CCc3c(C)n[nH]c3C)ccc2o1 |
| InChI | InChI=1S/C15H17N3O/c1-9-13(10(2)18-17-9)6-4-12-5-7-15-14(8-12)16-11(3)19-15/h5,7-8H,4,6H2,1-3H3,(H,17,18) |
| InChIKey | WHEDYZGFONJCGL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole?
The IUPAC name of 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole (CID 70731003) is 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole.
What is the SMILES notation for 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole?
The canonical SMILES for 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole is Cc1nc2cc(CCc3c(C)n[nH]c3C)ccc2o1.
What is the InChIKey of 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole?
The InChIKey is WHEDYZGFONJCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-9-13(10(2)18-17-9)6-4-12-5-7-15-14(8-12)16-11(3)19-15/h5,7-8H,4,6H2,1-3H3,(H,17,18).
What are the key properties of 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole?
5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole has a molecular weight of 255.32 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-1,3-benzoxazole is sourced from PubChem (CID 70731003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).