C18H33N5O3 — CID 70731405
1-[[5-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]piperidin-4-ol (PubChem CID 70731405) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[[5-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[[5-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 70731405 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-[[5-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]piperidin-4-ol |
| SMILES | Cn1c(CN2CCC(O)CC2)nnc1C1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C18H33N5O3/c1-21-17(14-23-8-4-16(25)5-9-23)19-20-18(21)15-2-6-22(7-3-15)10-12-26-13-11-24/h15-16,24-25H,2-14H2,1H3 |
| InChIKey | ZZURKWXQXZOFBM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|