C16H19N7OS — CID 70731435
4-N-methyl-4-N-(1,2-oxazol-3-ylmethyl)-7-(1,3-thiazol-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 70731435) has the molecular formula C16H19N7OS and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-N-methyl-4-N-(1,2-oxazol-3-ylmethyl)-7-(1,3-thiazol-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-methyl-4-N-(1,2-oxazol-3-ylmethyl)-7-(1,3-thiazol-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 70731435 |
| Molecular Formula | C16H19N7OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-N-methyl-4-N-(1,2-oxazol-3-ylmethyl)-7-(1,3-thiazol-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN(Cc1ccon1)c1nc(N)nc2c1CCN(c1nccs1)CC2 |
| InChI | InChI=1S/C16H19N7OS/c1-22(10-11-4-8-24-21-11)14-12-2-6-23(16-18-5-9-25-16)7-3-13(12)19-15(17)20-14/h4-5,8-9H,2-3,6-7,10H2,1H3,(H2,17,19,20) |
| InChIKey | FUHDTAAZJBKGAN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |