C16H31N3O — CID 707316
1-cyclohexyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 707316) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-cyclohexyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 707316 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 1-cyclohexyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)NC2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H31N3O/c1-15(2)10-13(11-16(3,4)19-15)18-14(20)17-12-8-6-5-7-9-12/h12-13,19H,5-11H2,1-4H3,(H2,17,18,20) |
| InChIKey | ROQXTAUUWSZSGL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |