C17H27N3O4S — CID 70732352
(4aR,7aS)-N-ethyl-6,6-dioxo-1-[(5-propylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70732352) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(5-propylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(5-propylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70732352 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(5-propylfuran-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCCc1ccc(CN2CCN(C(=O)NCC)[C@H]3CS(=O)(=O)C[C@H]32)o1 |
| InChI | InChI=1S/C17H27N3O4S/c1-3-5-13-6-7-14(24-13)10-19-8-9-20(17(21)18-4-2)16-12-25(22,23)11-15(16)19/h6-7,15-16H,3-5,8-12H2,1-2H3,(H,18,21)/t15-,16+/m1/s1 |
| InChIKey | ZXQLDUKSMJGPHB-CVEARBPZSA-N |
| XLogP | 1.24 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |