About 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid
1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid (PubChem CID 70732399) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid |
| PubChem CID | 70732399 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid |
| SMILES | Cc1nc(CN2CCC(C(=O)O)(n3ccc(C(C)C)n3)CC2)co1 |
| InChI | InChI=1S/C17H24N4O3/c1-12(2)15-4-7-21(19-15)17(16(22)23)5-8-20(9-6-17)10-14-11-24-13(3)18-14/h4,7,11-12H,5-6,8-10H2,1-3H3,(H,22,23) |
| InChIKey | LPRDWEXKXOEFRZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid?
The IUPAC name of 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid (CID 70732399) is 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid is Cc1nc(CN2CCC(C(=O)O)(n3ccc(C(C)C)n3)CC2)co1.
What is the InChIKey of 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid?
The InChIKey is LPRDWEXKXOEFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3/c1-12(2)15-4-7-21(19-15)17(16(22)23)5-8-20(9-6-17)10-14-11-24-13(3)18-14/h4,7,11-12H,5-6,8-10H2,1-3H3,(H,22,23).
What are the key properties of 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid?
1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid has a molecular weight of 332.40 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-oxazol-4-yl)methyl]-4-(3-propan-2-ylpyrazol-1-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 70732399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).