C14H23N3O5S2 — CID 70732444
[(4aR,7aS)-6,6-dioxo-4-pyrrolidin-1-ylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone (PubChem CID 70732444) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-4-pyrrolidin-1-ylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-4-pyrrolidin-1-ylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 70732444 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-4-pyrrolidin-1-ylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCN(S(=O)(=O)N2CCCC2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H23N3O5S2/c18-14(11-3-4-11)16-7-8-17(13-10-23(19,20)9-12(13)16)24(21,22)15-5-1-2-6-15/h11-13H,1-10H2/t12-,13+/m1/s1 |
| InChIKey | CSSCMKGNFPNLNB-OLZOCXBDSA-N |
| XLogP | -0.95 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |