C14H26NO2+ — CID 7073286
(3aS,4R,5S,7aR)-4-methyl-5-piperidin-1-ium-1-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-ol (PubChem CID 7073286) has the molecular formula C14H26NO2+ and a molecular weight of 240.37 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-4-methyl-5-piperidin-1-ium-1-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-ol.
| Compound Name | (3aS,4R,5S,7aR)-4-methyl-5-piperidin-1-ium-1-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-ol |
|---|---|
| PubChem CID | 7073286 |
| Molecular Formula | C14H26NO2+ |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | (3aS,4R,5S,7aR)-4-methyl-5-piperidin-1-ium-1-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-ol |
| SMILES | C[C@@]1(O)[C@@H]2COC[C@@H]2CC[C@@H]1[NH+]1CCCCC1 |
| InChI | InChI=1S/C14H25NO2/c1-14(16)12-10-17-9-11(12)5-6-13(14)15-7-3-2-4-8-15/h11-13,16H,2-10H2,1H3/p+1/t11-,12+,13-,14+/m0/s1 |
| InChIKey | IGEZJEREOXOJJR-RFQIPJPRSA-O |
| XLogP | 0.23 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |