C20H22FN3O2 — CID 70734493
2-[[1-(2-fluorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]methyl-methylamino]ethanol (PubChem CID 70734493) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]methyl-methylamino]ethanol.
| Compound Name | 2-[[1-(2-fluorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 70734493 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)-3-(4-methoxyphenyl)pyrazol-4-yl]methyl-methylamino]ethanol |
| SMILES | COc1ccc(-c2nn(-c3ccccc3F)cc2CN(C)CCO)cc1 |
| InChI | InChI=1S/C20H22FN3O2/c1-23(11-12-25)13-16-14-24(19-6-4-3-5-18(19)21)22-20(16)15-7-9-17(26-2)10-8-15/h3-10,14,25H,11-13H2,1-2H3 |
| InChIKey | SZJLMXRJFBVQTO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |