C18H26N2O5S — CID 70734738
[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(methoxymethyl)furan-2-yl]methanone (PubChem CID 70734738) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(methoxymethyl)furan-2-yl]methanone.
| Compound Name | [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(methoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 70734738 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(methoxymethyl)furan-2-yl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCN(CC=C(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)o1 |
| InChI | InChI=1S/C18H26N2O5S/c1-13(2)6-7-19-8-9-20(16-12-26(22,23)11-15(16)19)18(21)17-5-4-14(25-17)10-24-3/h4-6,15-16H,7-12H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | FTXZGHMNJFAEGF-CVEARBPZSA-N |
| XLogP | 1.32 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|