C17H24FNO3S — CID 70735599
1-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one (PubChem CID 70735599) has the molecular formula C17H24FNO3S and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one.
| Compound Name | 1-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one |
|---|---|
| PubChem CID | 70735599 |
| Molecular Formula | C17H24FNO3S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidin-1-yl]-3-[(4-fluorophenyl)methylsulfanyl]propan-1-one |
| SMILES | CC[C@@]1(O)CCN(C(=O)CCSCc2ccc(F)cc2)C[C@H]1O |
| InChI | InChI=1S/C17H24FNO3S/c1-2-17(22)8-9-19(11-15(17)20)16(21)7-10-23-12-13-3-5-14(18)6-4-13/h3-6,15,20,22H,2,7-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | LUOHXUWIQSLIML-NVXWUHKLSA-N |
| XLogP | 2.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|