C17H27N5O3S — CID 70735985
(4aS,7aR)-N,N-diethyl-1-[(2-methylpyrimidin-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70735985) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (4aS,7aR)-N,N-diethyl-1-[(2-methylpyrimidin-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-N,N-diethyl-1-[(2-methylpyrimidin-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70735985 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (4aS,7aR)-N,N-diethyl-1-[(2-methylpyrimidin-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(Cc2cnc(C)nc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H27N5O3S/c1-4-20(5-2)17(23)22-7-6-21(10-14-8-18-13(3)19-9-14)15-11-26(24,25)12-16(15)22/h8-9,15-16H,4-7,10-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | VTMNHHNEZDXESQ-JKSUJKDBSA-N |
| XLogP | 0.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |