C16H22N2O6S — CID 70736431
1-[(4aR,7aS)-4-[5-(methoxymethyl)furan-2-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one (PubChem CID 70736431) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-[5-(methoxymethyl)furan-2-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-[5-(methoxymethyl)furan-2-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70736431 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[(4aR,7aS)-4-[5-(methoxymethyl)furan-2-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2ccc(COC)o2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H22N2O6S/c1-3-15(19)17-6-7-18(13-10-25(21,22)9-12(13)17)16(20)14-5-4-11(24-14)8-23-2/h4-5,12-13H,3,6-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | XTMPWXJUWUJISK-OLZOCXBDSA-N |
| XLogP | 0.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |