C17H30N6O — CID 70736500
1,1-dimethyl-3-[[5-(piperidin-3-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea (PubChem CID 70736500) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[5-(piperidin-3-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea.
| Compound Name | 1,1-dimethyl-3-[[5-(piperidin-3-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 70736500 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1,1-dimethyl-3-[[5-(piperidin-3-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
| SMILES | CN(C)C(=O)NCc1cc2n(n1)CCCN(CC1CCCNC1)C2 |
| InChI | InChI=1S/C17H30N6O/c1-21(2)17(24)19-11-15-9-16-13-22(7-4-8-23(16)20-15)12-14-5-3-6-18-10-14/h9,14,18H,3-8,10-13H2,1-2H3,(H,19,24) |
| InChIKey | JXRSAMPTCPKXIJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |