About 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol
3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol (PubChem CID 70736578) has the molecular formula C15H20N4OS
and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol |
| PubChem CID | 70736578 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol |
| SMILES | OC1(CNCCc2csc(-c3cccnc3)n2)CCNC1 |
| InChI | InChI=1S/C15H20N4OS/c20-15(4-7-18-11-15)10-17-6-3-13-9-21-14(19-13)12-2-1-5-16-8-12/h1-2,5,8-9,17-18,20H,3-4,6-7,10-11H2 |
| InChIKey | SBFQQZVFNYHVOG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The IUPAC name of 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol (CID 70736578) is 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol.
What is the SMILES notation for 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The canonical SMILES for 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol is OC1(CNCCc2csc(-c3cccnc3)n2)CCNC1.
What is the InChIKey of 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The InChIKey is SBFQQZVFNYHVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS/c20-15(4-7-18-11-15)10-17-6-3-13-9-21-14(19-13)12-2-1-5-16-8-12/h1-2,5,8-9,17-18,20H,3-4,6-7,10-11H2.
What are the key properties of 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol has a molecular weight of 304.42 g/mol, XLogP of 1.06, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol is sourced from PubChem (CID 70736578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).