About ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate
ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate (PubChem CID 70736810) has the molecular formula C20H27N3O3
and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate |
| PubChem CID | 70736810 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(N2CCCC3(CCC(=O)N(C4CC4)C3)C2)n1 |
| InChI | InChI=1S/C20H27N3O3/c1-2-26-19(25)16-5-3-6-17(21-16)22-12-4-10-20(13-22)11-9-18(24)23(14-20)15-7-8-15/h3,5-6,15H,2,4,7-14H2,1H3 |
| InChIKey | QTOYYIWXOUNQBT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate?
The IUPAC name of ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate (CID 70736810) is ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate?
The canonical SMILES for ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate is CCOC(=O)c1cccc(N2CCCC3(CCC(=O)N(C4CC4)C3)C2)n1.
What is the InChIKey of ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate?
The InChIKey is QTOYYIWXOUNQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O3/c1-2-26-19(25)16-5-3-6-17(21-16)22-12-4-10-20(13-22)11-9-18(24)23(14-20)15-7-8-15/h3,5-6,15H,2,4,7-14H2,1H3.
What are the key properties of ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate?
ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate has a molecular weight of 357.45 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(2-cyclopropyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)pyridine-2-carboxylate is sourced from PubChem (CID 70736810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).