C16H23F3N2O — CID 70736956
[(3R,4R)-4-[[ethyl(methyl)amino]methyl]-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]methanol (PubChem CID 70736956) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is [(3R,4R)-4-[[ethyl(methyl)amino]methyl]-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]methanol.
| Compound Name | [(3R,4R)-4-[[ethyl(methyl)amino]methyl]-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 70736956 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(3R,4R)-4-[[ethyl(methyl)amino]methyl]-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]methanol |
| SMILES | CCN(C)C[C@@H]1CN(Cc2ccc(F)c(F)c2F)C[C@@H]1CO |
| InChI | InChI=1S/C16H23F3N2O/c1-3-20(2)6-12-8-21(9-13(12)10-22)7-11-4-5-14(17)16(19)15(11)18/h4-5,12-13,22H,3,6-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | SPVNJQFVJWFQQB-CHWSQXEVSA-N |
| XLogP | 2.10 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|