C21H25N5O2 — CID 70737159
(1-ethylpyrazol-4-yl)-[4-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methanone (PubChem CID 70737159) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-[4-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methanone.
| Compound Name | (1-ethylpyrazol-4-yl)-[4-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70737159 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-[4-[4-(3-methoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methanone |
| SMILES | CCn1cc(C(=O)N2CCC(c3[nH]ncc3-c3cccc(OC)c3)CC2)cn1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-26-14-17(12-23-26)21(27)25-9-7-15(8-10-25)20-19(13-22-24-20)16-5-4-6-18(11-16)28-2/h4-6,11-15H,3,7-10H2,1-2H3,(H,22,24) |
| InChIKey | DFDRWPKOAUVZOZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |