C16H18N6S2 — CID 70737878
4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-6-thiophen-2-ylsulfanylpyrimidin-2-amine (PubChem CID 70737878) has the molecular formula C16H18N6S2 and a molecular weight of 358.50 g/mol. Its IUPAC name is 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-6-thiophen-2-ylsulfanylpyrimidin-2-amine.
| Compound Name | 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-6-thiophen-2-ylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 70737878 |
| Molecular Formula | C16H18N6S2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[3-(1H-imidazol-2-yl)piperidin-1-yl]-6-thiophen-2-ylsulfanylpyrimidin-2-amine |
| SMILES | Nc1nc(Sc2cccs2)cc(N2CCCC(c3ncc[nH]3)C2)n1 |
| InChI | InChI=1S/C16H18N6S2/c17-16-20-12(9-13(21-16)24-14-4-2-8-23-14)22-7-1-3-11(10-22)15-18-5-6-19-15/h2,4-6,8-9,11H,1,3,7,10H2,(H,18,19)(H2,17,20,21) |
| InChIKey | IFDKJZFZSZBGBL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |