C16H19N5O4 — CID 70738128
1-(2-ethoxyethyl)-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 70738128) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70738128 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-(2-ethoxyethyl)-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCOCCn1c(=O)[nH]c2cc(C(=O)NCc3nnc(C)o3)ccc21 |
| InChI | InChI=1S/C16H19N5O4/c1-3-24-7-6-21-13-5-4-11(8-12(13)18-16(21)23)15(22)17-9-14-20-19-10(2)25-14/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,22)(H,18,23) |
| InChIKey | ULZXDMRTQFQGAI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|