C14H20N6O2 — CID 70738438
2-amino-3-ethyl-N-[4-(methylamino)-4-oxobutyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 70738438) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-amino-3-ethyl-N-[4-(methylamino)-4-oxobutyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 2-amino-3-ethyl-N-[4-(methylamino)-4-oxobutyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 70738438 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-amino-3-ethyl-N-[4-(methylamino)-4-oxobutyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCn1c(N)nc2cc(C(=O)NCCCC(=O)NC)cnc21 |
| InChI | InChI=1S/C14H20N6O2/c1-3-20-12-10(19-14(20)15)7-9(8-18-12)13(22)17-6-4-5-11(21)16-2/h7-8H,3-6H2,1-2H3,(H2,15,19)(H,16,21)(H,17,22) |
| InChIKey | FLAJKBLQEQNFOI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|