C14H18F4N4O3 — CID 70738457
N-[(6-morpholin-4-ylpyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 70738457) has the molecular formula C14H18F4N4O3 and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[(6-morpholin-4-ylpyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(6-morpholin-4-ylpyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 70738457 |
| Molecular Formula | C14H18F4N4O3 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[(6-morpholin-4-ylpyrimidin-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | O=C(COCC(F)(F)C(F)F)NCc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C14H18F4N4O3/c15-13(16)14(17,18)8-25-7-12(23)19-6-10-5-11(21-9-20-10)22-1-3-24-4-2-22/h5,9,13H,1-4,6-8H2,(H,19,23) |
| InChIKey | GZQNRDJFBSJGHW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|