About 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine
8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine (PubChem CID 70739111) has the molecular formula C17H14N4
and a molecular weight of 274.33 g/mol. Its IUPAC name is 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine.
Molecular Properties
| Compound Name | 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine |
| PubChem CID | 70739111 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine |
| SMILES | Cn1ccc2c(-c3cccc4c(N)ccnc34)ccnc21 |
| InChI | InChI=1S/C17H14N4/c1-21-10-7-13-11(5-8-20-17(13)21)12-3-2-4-14-15(18)6-9-19-16(12)14/h2-10H,1H3,(H2,18,19) |
| InChIKey | FPMWOTGMQRJJKW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine?
The IUPAC name of 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine (CID 70739111) is 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine.
What is the SMILES notation for 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine?
The canonical SMILES for 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine is Cn1ccc2c(-c3cccc4c(N)ccnc34)ccnc21.
What is the InChIKey of 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine?
The InChIKey is FPMWOTGMQRJJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4/c1-21-10-7-13-11(5-8-20-17(13)21)12-3-2-4-14-15(18)6-9-19-16(12)14/h2-10H,1H3,(H2,18,19).
What are the key properties of 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine?
8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine has a molecular weight of 274.33 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-methylpyrrolo[2,3-b]pyridin-4-yl)quinolin-4-amine is sourced from PubChem (CID 70739111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).