C19H26N4O2S — CID 70739114
(4aR,7aS)-1-[(2-ethylphenyl)methyl]-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70739114) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is (4aR,7aS)-1-[(2-ethylphenyl)methyl]-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-[(2-ethylphenyl)methyl]-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70739114 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (4aR,7aS)-1-[(2-ethylphenyl)methyl]-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCc1ccccc1CN1CCN(Cc2ncc[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C19H26N4O2S/c1-2-15-5-3-4-6-16(15)11-22-9-10-23(12-19-20-7-8-21-19)18-14-26(24,25)13-17(18)22/h3-8,17-18H,2,9-14H2,1H3,(H,20,21)/t17-,18+/m1/s1 |
| InChIKey | AHJFBUXQQVIOGZ-MSOLQXFVSA-N |
| XLogP | 1.46 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |