C15H20N6O3S — CID 70739116
5-methyl-N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrazine-2-carboxamide (PubChem CID 70739116) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 5-methyl-N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70739116 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-methyl-N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)cn1 |
| InChI | InChI=1S/C15H20N6O3S/c1-11-7-17-14(9-16-11)15(22)18-8-12-6-13-10-20(25(2,23)24)4-3-5-21(13)19-12/h6-7,9H,3-5,8,10H2,1-2H3,(H,18,22) |
| InChIKey | ZBEBATZZUDDTPZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |