C18H30N6O2 — CID 70739670
(4aS,8aR)-6-(2-amino-6-propan-2-yloxypyrimidin-4-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70739670) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (4aS,8aR)-6-(2-amino-6-propan-2-yloxypyrimidin-4-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(2-amino-6-propan-2-yloxypyrimidin-4-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70739670 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (4aS,8aR)-6-(2-amino-6-propan-2-yloxypyrimidin-4-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(c3cc(OC(C)C)nc(N)n3)CC[C@H]21 |
| InChI | InChI=1S/C18H30N6O2/c1-12(2)26-16-10-15(21-18(19)22-16)23-8-6-14-13(11-23)4-5-17(25)24(14)9-7-20-3/h10,12-14,20H,4-9,11H2,1-3H3,(H2,19,21,22)/t13-,14+/m0/s1 |
| InChIKey | JSPPLQFWVYOVOF-UONOGXRCSA-N |
| XLogP | 0.88 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |