C13H21N5O2S — CID 70740748
4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N-ethyl-N-methylpyrimidin-2-amine (PubChem CID 70740748) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N-ethyl-N-methylpyrimidin-2-amine.
| Compound Name | 4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N-ethyl-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 70740748 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N-ethyl-N-methylpyrimidin-2-amine |
| SMILES | CCN(C)c1nccc(N2CCN[C@H]3CS(=O)(=O)C[C@H]32)n1 |
| InChI | InChI=1S/C13H21N5O2S/c1-3-17(2)13-15-5-4-12(16-13)18-7-6-14-10-8-21(19,20)9-11(10)18/h4-5,10-11,14H,3,6-9H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | MYCJWBGTZOZAMI-WDEREUQCSA-N |
| XLogP | -0.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |