C15H14N6O4 — CID 70741018
2-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid (PubChem CID 70741018) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 70741018 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]pyrimidin-4-yl]pyridine-4-carboxylic acid |
| SMILES | Cc1nonc1OCCNc1nccc(-c2cc(C(=O)O)ccn2)n1 |
| InChI | InChI=1S/C15H14N6O4/c1-9-13(21-25-20-9)24-7-6-18-15-17-5-3-11(19-15)12-8-10(14(22)23)2-4-16-12/h2-5,8H,6-7H2,1H3,(H,22,23)(H,17,18,19) |
| InChIKey | XHLYMBLABRVOAA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|