C22H25N3O3 — CID 70741520
1-[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-2-(3-methoxyphenoxy)ethanone (PubChem CID 70741520) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-2-(3-methoxyphenoxy)ethanone.
| Compound Name | 1-[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-2-(3-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 70741520 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-2-(3-methoxyphenoxy)ethanone |
| SMILES | COc1cccc(OCC(=O)N2CCCC(Cc3nc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-17-7-4-8-18(13-17)28-15-22(26)25-11-5-6-16(14-25)12-21-23-19-9-2-3-10-20(19)24-21/h2-4,7-10,13,16H,5-6,11-12,14-15H2,1H3,(H,23,24) |
| InChIKey | NJEHPKMXVWFPDE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |