C15H21N5O4S — CID 70742817
[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-morpholin-4-ylmethanone (PubChem CID 70742817) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 70742817 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CCN(c2ncccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H21N5O4S/c21-15(18-6-8-24-9-7-18)20-5-4-19(14-16-2-1-3-17-14)12-10-25(22,23)11-13(12)20/h1-3,12-13H,4-11H2/t12-,13+/m1/s1 |
| InChIKey | GPHLNQRWJIWFPI-OLZOCXBDSA-N |
| XLogP | -0.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |