C15H22FN5O — CID 70743436
(4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70743436) has the molecular formula C15H22FN5O and a molecular weight of 307.37 g/mol. Its IUPAC name is (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70743436 |
| Molecular Formula | C15H22FN5O |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(c3ncc(F)cn3)CC[C@H]21 |
| InChI | InChI=1S/C15H22FN5O/c1-17-5-7-21-13-4-6-20(10-11(13)2-3-14(21)22)15-18-8-12(16)9-19-15/h8-9,11,13,17H,2-7,10H2,1H3/t11-,13+/m0/s1 |
| InChIKey | VIXWDARZJJHZQB-WCQYABFASA-N |
| XLogP | 0.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |